C9H6F7NO2S — CID 167079780
2,3,4,5-tetrafluoro-N,N-dimethyl-6-(trifluoromethyl)benzenesulfonamide (PubChem CID 167079780) has the molecular formula C9H6F7NO2S and a molecular weight of 325.21 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N,N-dimethyl-6-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2,3,4,5-tetrafluoro-N,N-dimethyl-6-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 167079780 |
| Molecular Formula | C9H6F7NO2S |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N,N-dimethyl-6-(trifluoromethyl)benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1C(F)(F)F |
| InChI | InChI=1S/C9H6F7NO2S/c1-17(2)20(18,19)8-3(9(14,15)16)4(10)5(11)6(12)7(8)13/h1-2H3 |
| InChIKey | LUKKIAFFIOFECB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|