C10H6F10 — CID 145102025
ethane;1,2,3,5-tetrafluoro-4,6-bis(trifluoromethyl)benzene (PubChem CID 145102025) has the molecular formula C10H6F10 and a molecular weight of 316.14 g/mol. Its IUPAC name is ethane;1,2,3,5-tetrafluoro-4,6-bis(trifluoromethyl)benzene.
| Compound Name | ethane;1,2,3,5-tetrafluoro-4,6-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 145102025 |
| Molecular Formula | C10H6F10 |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | ethane;1,2,3,5-tetrafluoro-4,6-bis(trifluoromethyl)benzene |
| SMILES | CC.Fc1c(F)c(C(F)(F)F)c(F)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C8F10.C2H6/c9-3-1(7(13,14)15)4(10)6(12)5(11)2(3)8(16,17)18;1-2/h;1-2H3 |
| InChIKey | HCUAZHGPHQLDQA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|