C14F14O — CID 174560482
1,2,3,5-tetrafluoro-4-[2,3,4,6-tetrafluoro-5-(trifluoromethyl)phenoxy]-6-(trifluoromethyl)benzene (PubChem CID 174560482) has the molecular formula C14F14O and a molecular weight of 450.13 g/mol. Its IUPAC name is 1,2,3,5-tetrafluoro-4-[2,3,4,6-tetrafluoro-5-(trifluoromethyl)phenoxy]-6-(trifluoromethyl)benzene.
| Compound Name | 1,2,3,5-tetrafluoro-4-[2,3,4,6-tetrafluoro-5-(trifluoromethyl)phenoxy]-6-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 174560482 |
| Molecular Formula | C14F14O |
| Molecular Weight | 450.13 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | 1,2,3,5-tetrafluoro-4-[2,3,4,6-tetrafluoro-5-(trifluoromethyl)phenoxy]-6-(trifluoromethyl)benzene |
| SMILES | Fc1c(F)c(Oc2c(F)c(F)c(F)c(C(F)(F)F)c2F)c(F)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C14F14O/c15-3-1(13(23,24)25)5(17)11(9(21)7(3)19)29-12-6(18)2(14(26,27)28)4(16)8(20)10(12)22 |
| InChIKey | GDYPPHYUYFMGED-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.13 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|