C7H3F7Si — CID 154500712
[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane (PubChem CID 154500712) has the molecular formula C7H3F7Si and a molecular weight of 248.17 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane.
| Compound Name | [2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane |
|---|---|
| PubChem CID | 154500712 |
| Molecular Formula | C7H3F7Si |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane |
| SMILES | Fc1c(F)c(C(F)(F)F)c(F)c(F)c1[SiH3] |
| InChI | InChI=1S/C7H3F7Si/c8-2-1(7(12,13)14)3(9)5(11)6(15)4(2)10/h15H3 |
| InChIKey | QENIOGYZDRAWPY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|