C8H2BrF7Zn — CID 146001695
bromozinc(1+);1,2,4,5-tetrafluoro-3-methanidyl-6-(trifluoromethyl)benzene (PubChem CID 146001695) has the molecular formula C8H2BrF7Zn and a molecular weight of 376.38 g/mol. Its IUPAC name is bromozinc(1+);1,2,4,5-tetrafluoro-3-methanidyl-6-(trifluoromethyl)benzene.
| Compound Name | bromozinc(1+);1,2,4,5-tetrafluoro-3-methanidyl-6-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 146001695 |
| Molecular Formula | C8H2BrF7Zn |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 373.85 |
| IUPAC Name | bromozinc(1+);1,2,4,5-tetrafluoro-3-methanidyl-6-(trifluoromethyl)benzene |
| SMILES | [CH2-]c1c(F)c(F)c(C(F)(F)F)c(F)c1F.[Zn+]Br |
| InChI | InChI=1S/C8H2F7.BrH.Zn/c1-2-4(9)6(11)3(8(13,14)15)7(12)5(2)10;;/h1H2;1H;/q-1;;+2/p-1 |
| InChIKey | MECRSIUSLHZQOX-UHFFFAOYSA-M |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|