C13F12S — CID 177256045
1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanylbenzene (PubChem CID 177256045) has the molecular formula C13F12S and a molecular weight of 416.19 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanylbenzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanylbenzene |
|---|---|
| PubChem CID | 177256045 |
| Molecular Formula | C13F12S |
| Molecular Weight | 416.19 g/mol |
| Exact Mass | 415.95 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanylbenzene |
| SMILES | Fc1c(F)c(F)c(Sc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C13F12S/c14-2-1(13(23,24)25)3(15)8(20)11(7(2)19)26-12-9(21)5(17)4(16)6(18)10(12)22 |
| InChIKey | OEUPHPKIYVVPQB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.19 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|