C14F14S — CID 129161534
1-[[difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]sulfanyl-difluoromethyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 129161534) has the molecular formula C14F14S and a molecular weight of 466.19 g/mol. Its IUPAC name is 1-[[difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]sulfanyl-difluoromethyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[[difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]sulfanyl-difluoromethyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 129161534 |
| Molecular Formula | C14F14S |
| Molecular Weight | 466.19 g/mol |
| Exact Mass | 465.95 |
| IUPAC Name | 1-[[difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]sulfanyl-difluoromethyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | Fc1c(F)c(F)c(C(F)(F)SC(F)(F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C14F14S/c15-3-1(4(16)8(20)11(23)7(3)19)13(25,26)29-14(27,28)2-5(17)9(21)12(24)10(22)6(2)18 |
| InChIKey | BCKIQUFGXZFFPT-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.19 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|