C20F19N — CID 171479860
N,N,1,1-tetrafluoro-2,2,2-tris(2,3,4,5,6-pentafluorophenyl)ethanamine (PubChem CID 171479860) has the molecular formula C20F19N and a molecular weight of 615.19 g/mol. Its IUPAC name is N,N,1,1-tetrafluoro-2,2,2-tris(2,3,4,5,6-pentafluorophenyl)ethanamine.
| Compound Name | N,N,1,1-tetrafluoro-2,2,2-tris(2,3,4,5,6-pentafluorophenyl)ethanamine |
|---|---|
| PubChem CID | 171479860 |
| Molecular Formula | C20F19N |
| Molecular Weight | 615.19 g/mol |
| Exact Mass | 614.97 |
| IUPAC Name | N,N,1,1-tetrafluoro-2,2,2-tris(2,3,4,5,6-pentafluorophenyl)ethanamine |
| SMILES | Fc1c(F)c(F)c(C(c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)C(F)(F)N(F)F)c(F)c1F |
| InChI | InChI=1S/C20F19N/c21-4-1(5(22)11(28)16(33)10(4)27)19(20(36,37)40(38)39,2-6(23)12(29)17(34)13(30)7(2)24)3-8(25)14(31)18(35)15(32)9(3)26 |
| InChIKey | YACYZLOBYUKRNO-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.19 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|