C9Br2F10 — CID 98114468
1-[(2S)-2,3-dibromo-1,1,2,3,3-pentafluoropropyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 98114468) has the molecular formula C9Br2F10 and a molecular weight of 457.89 g/mol. Its IUPAC name is 1-[(2S)-2,3-dibromo-1,1,2,3,3-pentafluoropropyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[(2S)-2,3-dibromo-1,1,2,3,3-pentafluoropropyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 98114468 |
| Molecular Formula | C9Br2F10 |
| Molecular Weight | 457.89 g/mol |
| Exact Mass | 455.82 |
| IUPAC Name | 1-[(2S)-2,3-dibromo-1,1,2,3,3-pentafluoropropyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | Fc1c(F)c(F)c(C(F)(F)[C@](F)(Br)C(F)(F)Br)c(F)c1F |
| InChI | InChI=1S/C9Br2F10/c10-8(19,9(11,20)21)7(17,18)1-2(12)4(14)6(16)5(15)3(1)13/t8-/m1/s1 |
| InChIKey | WUIPOYULXDZVKV-MRVPVSSYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.89 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|