C12F10MnS2 — CID 122226400
manganese(2+);bis(2,3,4,5,6-pentafluorobenzenethiolate) (PubChem CID 122226400) has the molecular formula C12F10MnS2 and a molecular weight of 453.18 g/mol. Its IUPAC name is manganese(2+);bis(2,3,4,5,6-pentafluorobenzenethiolate).
| Compound Name | manganese(2+);bis(2,3,4,5,6-pentafluorobenzenethiolate) |
|---|---|
| PubChem CID | 122226400 |
| Molecular Formula | C12F10MnS2 |
| Molecular Weight | 453.18 g/mol |
| Exact Mass | 452.87 |
| IUPAC Name | manganese(2+);bis(2,3,4,5,6-pentafluorobenzenethiolate) |
| SMILES | Fc1c(F)c(F)c([S-])c(F)c1F.Fc1c(F)c(F)c([S-])c(F)c1F.[Mn+2] |
| InChI | InChI=1S/2C6HF5S.Mn/c2*7-1-2(8)4(10)6(12)5(11)3(1)9;/h2*12H;/q;;+2/p-2 |
| InChIKey | ACVMDOLIZCNJRH-UHFFFAOYSA-L |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.18 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|