C12F8NiS4-4 — CID 153483427
nickel;bis(3,4,5,6-tetrafluorobenzene-1,2-dithiolate) (PubChem CID 153483427) has the molecular formula C12F8NiS4-4 and a molecular weight of 483.08 g/mol. Its IUPAC name is nickel;bis(3,4,5,6-tetrafluorobenzene-1,2-dithiolate).
| Compound Name | nickel;bis(3,4,5,6-tetrafluorobenzene-1,2-dithiolate) |
|---|---|
| PubChem CID | 153483427 |
| Molecular Formula | C12F8NiS4-4 |
| Molecular Weight | 483.08 g/mol |
| Exact Mass | 481.81 |
| IUPAC Name | nickel;bis(3,4,5,6-tetrafluorobenzene-1,2-dithiolate) |
| SMILES | Fc1c(F)c(F)c([S-])c([S-])c1F.Fc1c(F)c(F)c([S-])c([S-])c1F.[Ni] |
| InChI | InChI=1S/2C6H2F4S2.Ni/c2*7-1-2(8)4(10)6(12)5(11)3(1)9;/h2*11-12H;/p-4 |
| InChIKey | YYZQMINEYFYWNF-UHFFFAOYSA-J |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.08 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|