C6H2F4S2 — CID 12529684
2,3,5,6-tetrafluorobenzene-1,4-dithiol (PubChem CID 12529684) has the molecular formula C6H2F4S2 and a molecular weight of 214.21 g/mol. Its IUPAC name is 2,3,5,6-tetrafluorobenzene-1,4-dithiol.
| Compound Name | 2,3,5,6-tetrafluorobenzene-1,4-dithiol |
|---|---|
| PubChem CID | 12529684 |
| Molecular Formula | C6H2F4S2 |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 213.95 |
| IUPAC Name | 2,3,5,6-tetrafluorobenzene-1,4-dithiol |
| SMILES | Fc1c(F)c(S)c(F)c(F)c1S |
| InChI | InChI=1S/C6H2F4S2/c7-1-2(8)6(12)4(10)3(9)5(1)11/h11-12H |
| InChIKey | XGVLHDCPSWHAKN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|