C7H3F5S2 — CID 87156064
1,2,3,4,5-pentafluoro-6-(methyldisulfanyl)benzene (PubChem CID 87156064) has the molecular formula C7H3F5S2 and a molecular weight of 246.22 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(methyldisulfanyl)benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(methyldisulfanyl)benzene |
|---|---|
| PubChem CID | 87156064 |
| Molecular Formula | C7H3F5S2 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 245.96 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(methyldisulfanyl)benzene |
| SMILES | CSSc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7H3F5S2/c1-13-14-7-5(11)3(9)2(8)4(10)6(7)12/h1H3 |
| InChIKey | CTVLIAFILDCLGW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|