C6H2F5PS2 — CID 170719558
(2,3,4,5-tetrafluoro-6-phosphanylsulfanylphenyl) thiohypofluorite (PubChem CID 170719558) has the molecular formula C6H2F5PS2 and a molecular weight of 264.18 g/mol. Its IUPAC name is (2,3,4,5-tetrafluoro-6-phosphanylsulfanylphenyl) thiohypofluorite.
| Compound Name | (2,3,4,5-tetrafluoro-6-phosphanylsulfanylphenyl) thiohypofluorite |
|---|---|
| PubChem CID | 170719558 |
| Molecular Formula | C6H2F5PS2 |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 263.93 |
| IUPAC Name | (2,3,4,5-tetrafluoro-6-phosphanylsulfanylphenyl) thiohypofluorite |
| SMILES | FSc1c(F)c(F)c(F)c(F)c1SP |
| InChI | InChI=1S/C6H2F5PS2/c7-1-2(8)4(10)6(14-12)5(13-11)3(1)9/h12H2 |
| InChIKey | LODZDKIJDGPZSO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|