C14H7F10NS2 — CID 144769240
ethane;1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)sulfanylamino]sulfanylbenzene (PubChem CID 144769240) has the molecular formula C14H7F10NS2 and a molecular weight of 443.33 g/mol. Its IUPAC name is ethane;1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)sulfanylamino]sulfanylbenzene.
| Compound Name | ethane;1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)sulfanylamino]sulfanylbenzene |
|---|---|
| PubChem CID | 144769240 |
| Molecular Formula | C14H7F10NS2 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | ethane;1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)sulfanylamino]sulfanylbenzene |
| SMILES | CC.Fc1c(F)c(F)c(SNSc2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C12HF10NS2.C2H6/c13-1-3(15)7(19)11(8(20)4(1)16)24-23-25-12-9(21)5(17)2(14)6(18)10(12)22;1-2/h23H;1-2H3 |
| InChIKey | IHXSTPRVGMGGCR-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|