C10HF8N3S2 — CID 171106738
2,3,5,6-tetrafluoro-4-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanylamino]sulfanylpyridine (PubChem CID 171106738) has the molecular formula C10HF8N3S2 and a molecular weight of 379.26 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanylamino]sulfanylpyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanylamino]sulfanylpyridine |
|---|---|
| PubChem CID | 171106738 |
| Molecular Formula | C10HF8N3S2 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 378.95 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanylamino]sulfanylpyridine |
| SMILES | Fc1nc(F)c(F)c(SNSc2c(F)c(F)nc(F)c2F)c1F |
| InChI | InChI=1S/C10HF8N3S2/c11-1-5(2(12)8(16)19-7(1)15)22-21-23-6-3(13)9(17)20-10(18)4(6)14/h21H |
| InChIKey | WNNZSCPGHUNOTR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|