C7F9NS — CID 14930920
2,3,5,6-tetrafluoro-4-(1,1,2,2,2-pentafluoroethylsulfanyl)pyridine (PubChem CID 14930920) has the molecular formula C7F9NS and a molecular weight of 301.13 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(1,1,2,2,2-pentafluoroethylsulfanyl)pyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-(1,1,2,2,2-pentafluoroethylsulfanyl)pyridine |
|---|---|
| PubChem CID | 14930920 |
| Molecular Formula | C7F9NS |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.96 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(1,1,2,2,2-pentafluoroethylsulfanyl)pyridine |
| SMILES | Fc1nc(F)c(F)c(SC(F)(F)C(F)(F)F)c1F |
| InChI | InChI=1S/C7F9NS/c8-1-3(2(9)5(11)17-4(1)10)18-7(15,16)6(12,13)14 |
| InChIKey | NFHDSQVNRSFHMC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|