C8F9N — CID 139264129
2,3,5,6-tetrafluoro-4-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]pyridine (PubChem CID 139264129) has the molecular formula C8F9N and a molecular weight of 281.08 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]pyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]pyridine |
|---|---|
| PubChem CID | 139264129 |
| Molecular Formula | C8F9N |
| Molecular Weight | 281.08 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]pyridine |
| SMILES | F/C(=C(/F)C(F)(F)F)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C8F9N/c9-2(5(12)8(15,16)17)1-3(10)6(13)18-7(14)4(1)11/b5-2+ |
| InChIKey | LPFZWPRSBAZKGW-GORDUTHDSA-N |
| XLogP | 3.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.08 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|