C13F17N — CID 102119081
2,3,5,6-tetrafluoro-4-[(2E,4E)-1,1,1,5,6,6,6-heptafluoro-3,4-bis(trifluoromethyl)hexa-2,4-dien-2-yl]pyridine (PubChem CID 102119081) has the molecular formula C13F17N and a molecular weight of 493.12 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[(2E,4E)-1,1,1,5,6,6,6-heptafluoro-3,4-bis(trifluoromethyl)hexa-2,4-dien-2-yl]pyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-[(2E,4E)-1,1,1,5,6,6,6-heptafluoro-3,4-bis(trifluoromethyl)hexa-2,4-dien-2-yl]pyridine |
|---|---|
| PubChem CID | 102119081 |
| Molecular Formula | C13F17N |
| Molecular Weight | 493.12 g/mol |
| Exact Mass | 492.98 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[(2E,4E)-1,1,1,5,6,6,6-heptafluoro-3,4-bis(trifluoromethyl)hexa-2,4-dien-2-yl]pyridine |
| SMILES | F/C(=C(C(=C(\c1c(F)c(F)nc(F)c1F)C(F)(F)F)\C(F)(F)F)/C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13F17N/c14-5-1(6(15)9(18)31-8(5)17)2(10(19,20)21)3(11(22,23)24)4(12(25,26)27)7(16)13(28,29)30/b3-2+,7-4+ |
| InChIKey | WXMMBGPPVGZGIR-AOGGBPEJSA-N |
| XLogP | 6.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.12 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|