C14HF17 — CID 10482785
1,2,3,4,5-pentafluoro-6-[(2Z)-1,1,1,6,6,6-hexafluoro-3,4-bis(trifluoromethyl)hexa-2,4-dien-2-yl]benzene (PubChem CID 10482785) has the molecular formula C14HF17 and a molecular weight of 492.13 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[(2Z)-1,1,1,6,6,6-hexafluoro-3,4-bis(trifluoromethyl)hexa-2,4-dien-2-yl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[(2Z)-1,1,1,6,6,6-hexafluoro-3,4-bis(trifluoromethyl)hexa-2,4-dien-2-yl]benzene |
|---|---|
| PubChem CID | 10482785 |
| Molecular Formula | C14HF17 |
| Molecular Weight | 492.13 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[(2Z)-1,1,1,6,6,6-hexafluoro-3,4-bis(trifluoromethyl)hexa-2,4-dien-2-yl]benzene |
| SMILES | Fc1c(F)c(F)c(/C(=C(\C(=CC(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C14HF17/c15-6-3(7(16)9(18)10(19)8(6)17)5(14(29,30)31)4(13(26,27)28)2(12(23,24)25)1-11(20,21)22/h1H/b2-1?,5-4- |
| InChIKey | UGBXIAYUZOAYFP-VTWQNXAQSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.13 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|