C9H2F8 — CID 23236517
1,2,3,4,5-pentafluoro-6-(3,3,3-trifluoroprop-1-en-2-yl)benzene (PubChem CID 23236517) has the molecular formula C9H2F8 and a molecular weight of 262.10 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(3,3,3-trifluoroprop-1-en-2-yl)benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(3,3,3-trifluoroprop-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 23236517 |
| Molecular Formula | C9H2F8 |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(3,3,3-trifluoroprop-1-en-2-yl)benzene |
| SMILES | C=C(c1c(F)c(F)c(F)c(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C9H2F8/c1-2(9(15,16)17)3-4(10)6(12)8(14)7(13)5(3)11/h1H2 |
| InChIKey | UIHVAMFYVANNNL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|