C8HCl2F13 — CID 88615008
2,3-dichloro-1,1,1,4,4,4-hexafluorobut-2-ene;1,1,1,2,4,4,4-heptafluorobut-2-ene (PubChem CID 88615008) has the molecular formula C8HCl2F13 and a molecular weight of 414.98 g/mol. Its IUPAC name is 2,3-dichloro-1,1,1,4,4,4-hexafluorobut-2-ene;1,1,1,2,4,4,4-heptafluorobut-2-ene.
| Compound Name | 2,3-dichloro-1,1,1,4,4,4-hexafluorobut-2-ene;1,1,1,2,4,4,4-heptafluorobut-2-ene |
|---|---|
| PubChem CID | 88615008 |
| Molecular Formula | C8HCl2F13 |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 413.92 |
| IUPAC Name | 2,3-dichloro-1,1,1,4,4,4-hexafluorobut-2-ene;1,1,1,2,4,4,4-heptafluorobut-2-ene |
| SMILES | FC(=CC(F)(F)F)C(F)(F)F.FC(F)(F)C(Cl)=C(Cl)C(F)(F)F |
| InChI | InChI=1S/C4Cl2F6.C4HF7/c5-1(3(7,8)9)2(6)4(10,11)12;5-2(4(9,10)11)1-3(6,7)8/h;1H |
| InChIKey | MMIIPXYUBRKJDB-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |