C4HCl4F3 — CID 121234505
(Z)-1,1,1,2-tetrachloro-4,4,4-trifluorobut-2-ene (PubChem CID 121234505) has the molecular formula C4HCl4F3 and a molecular weight of 247.86 g/mol. Its IUPAC name is (Z)-1,1,1,2-tetrachloro-4,4,4-trifluorobut-2-ene.
| Compound Name | (Z)-1,1,1,2-tetrachloro-4,4,4-trifluorobut-2-ene |
|---|---|
| PubChem CID | 121234505 |
| Molecular Formula | C4HCl4F3 |
| Molecular Weight | 247.86 g/mol |
| Exact Mass | 245.88 |
| IUPAC Name | (Z)-1,1,1,2-tetrachloro-4,4,4-trifluorobut-2-ene |
| SMILES | FC(F)(F)/C=C(\Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4HCl4F3/c5-2(4(6,7)8)1-3(9,10)11/h1H/b2-1- |
| InChIKey | JHCZHQLFRVCYPU-UPHRSURJSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.86 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|