C6H4F8 — CID 158693197
(Z)-1,2,3,3,3-pentafluoroprop-1-ene;3,3,3-trifluoroprop-1-ene (PubChem CID 158693197) has the molecular formula C6H4F8 and a molecular weight of 228.08 g/mol. Its IUPAC name is (Z)-1,2,3,3,3-pentafluoroprop-1-ene;3,3,3-trifluoroprop-1-ene.
| Compound Name | (Z)-1,2,3,3,3-pentafluoroprop-1-ene;3,3,3-trifluoroprop-1-ene |
|---|---|
| PubChem CID | 158693197 |
| Molecular Formula | C6H4F8 |
| Molecular Weight | 228.08 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | (Z)-1,2,3,3,3-pentafluoroprop-1-ene;3,3,3-trifluoroprop-1-ene |
| SMILES | C=CC(F)(F)F.F/C=C(\F)C(F)(F)F |
| InChI | InChI=1S/C3HF5.C3H3F3/c4-1-2(5)3(6,7)8;1-2-3(4,5)6/h1H;2H,1H2/b2-1-; |
| InChIKey | IGPOAAABHGJIHW-ODZAUARKSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.08 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|