C11H14F4 — CID 54410794
1-ethenyl-4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexane (PubChem CID 54410794) has the molecular formula C11H14F4 and a molecular weight of 222.22 g/mol. Its IUPAC name is 1-ethenyl-4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexane.
| Compound Name | 1-ethenyl-4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexane |
|---|---|
| PubChem CID | 54410794 |
| Molecular Formula | C11H14F4 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 1-ethenyl-4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexane |
| SMILES | C=CC1CCC(C=C(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H14F4/c1-2-8-3-5-9(6-4-8)7-10(12)11(13,14)15/h2,7-9H,1,3-6H2 |
| InChIKey | VTYWQJPVYDNAML-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|