C9Cl4F6 — CID 14091783
1,2,3,4,5-pentafluoro-6-[(Z)-1,3,3,3-tetrachloro-2-fluoroprop-1-enyl]benzene (PubChem CID 14091783) has the molecular formula C9Cl4F6 and a molecular weight of 363.90 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[(Z)-1,3,3,3-tetrachloro-2-fluoroprop-1-enyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[(Z)-1,3,3,3-tetrachloro-2-fluoroprop-1-enyl]benzene |
|---|---|
| PubChem CID | 14091783 |
| Molecular Formula | C9Cl4F6 |
| Molecular Weight | 363.90 g/mol |
| Exact Mass | 361.87 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[(Z)-1,3,3,3-tetrachloro-2-fluoroprop-1-enyl]benzene |
| SMILES | F/C(=C(\Cl)c1c(F)c(F)c(F)c(F)c1F)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9Cl4F6/c10-2(8(19)9(11,12)13)1-3(14)5(16)7(18)6(17)4(1)15/b8-2- |
| InChIKey | TXVQUQZZGDKFCE-WAPJZHGLSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.90 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|