C7F9KN2O2S — CID 155632473
potassium trifluoromethylsulfonyl-[2,3,5-trifluoro-6-(trifluoromethyl)-4-pyridinyl]azanide (PubChem CID 155632473) has the molecular formula C7F9KN2O2S and a molecular weight of 386.24 g/mol. Its IUPAC name is potassium trifluoromethylsulfonyl-[2,3,5-trifluoro-6-(trifluoromethyl)-4-pyridinyl]azanide.
| Compound Name | potassium trifluoromethylsulfonyl-[2,3,5-trifluoro-6-(trifluoromethyl)-4-pyridinyl]azanide |
|---|---|
| PubChem CID | 155632473 |
| Molecular Formula | C7F9KN2O2S |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 385.92 |
| IUPAC Name | potassium trifluoromethylsulfonyl-[2,3,5-trifluoro-6-(trifluoromethyl)-4-pyridinyl]azanide |
| SMILES | O=S(=O)([N-]c1c(F)c(F)nc(C(F)(F)F)c1F)C(F)(F)F.[K+] |
| InChI | InChI=1S/C7F9N2O2S.K/c8-1-3(18-21(19,20)7(14,15)16)2(9)5(10)17-4(1)6(11,12)13;/q-1;+1 |
| InChIKey | UDBZJUDTSUUOKD-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 61.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|