C12H11F5NO3P — CID 167219804
(Z)-3-[2,3-difluoro-5-phosphanyl-6-(trifluoromethyl)-4-pyridinyl]-4-methylperoxypent-3-en-2-one (PubChem CID 167219804) has the molecular formula C12H11F5NO3P and a molecular weight of 343.19 g/mol. Its IUPAC name is (Z)-3-[2,3-difluoro-5-phosphanyl-6-(trifluoromethyl)-4-pyridinyl]-4-methylperoxypent-3-en-2-one.
| Compound Name | (Z)-3-[2,3-difluoro-5-phosphanyl-6-(trifluoromethyl)-4-pyridinyl]-4-methylperoxypent-3-en-2-one |
|---|---|
| PubChem CID | 167219804 |
| Molecular Formula | C12H11F5NO3P |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | (Z)-3-[2,3-difluoro-5-phosphanyl-6-(trifluoromethyl)-4-pyridinyl]-4-methylperoxypent-3-en-2-one |
| SMILES | COO/C(C)=C(\C(C)=O)c1c(F)c(F)nc(C(F)(F)F)c1P |
| InChI | InChI=1S/C12H11F5NO3P/c1-4(19)6(5(2)21-20-3)7-8(13)11(14)18-10(9(7)22)12(15,16)17/h22H2,1-3H3/b6-5+ |
| InChIKey | XZCMYCXSLAZMLR-AATRIKPKSA-N |
| XLogP | 2.78 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|