C10H7F6NO4 — CID 134677123
methyl 3-methoxy-6-(trifluoromethoxy)-2-(trifluoromethyl)pyridine-4-carboxylate (PubChem CID 134677123) has the molecular formula C10H7F6NO4 and a molecular weight of 319.16 g/mol. Its IUPAC name is methyl 3-methoxy-6-(trifluoromethoxy)-2-(trifluoromethyl)pyridine-4-carboxylate.
| Compound Name | methyl 3-methoxy-6-(trifluoromethoxy)-2-(trifluoromethyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 134677123 |
| Molecular Formula | C10H7F6NO4 |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | methyl 3-methoxy-6-(trifluoromethoxy)-2-(trifluoromethyl)pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(OC(F)(F)F)nc(C(F)(F)F)c1OC |
| InChI | InChI=1S/C10H7F6NO4/c1-19-6-4(8(18)20-2)3-5(21-10(14,15)16)17-7(6)9(11,12)13/h3H,1-2H3 |
| InChIKey | ODZMFWXSPSAJOT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |