About 5-chloro-2,4-difluoro-6-(trifluoromethyl)pyrimidine
5-chloro-2,4-difluoro-6-(trifluoromethyl)pyrimidine (PubChem CID 3057449) has the molecular formula C5ClF5N2
and a molecular weight of 218.51 g/mol. Its IUPAC name is 5-chloro-2,4-difluoro-6-(trifluoromethyl)pyrimidine.
Analyze 5-chloro-2,4-difluoro-6-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,4-difluoro-6-(trifluoromethyl)pyrimidine?
The IUPAC name of 5-chloro-2,4-difluoro-6-(trifluoromethyl)pyrimidine (CID 3057449) is 5-chloro-2,4-difluoro-6-(trifluoromethyl)pyrimidine.
What is the SMILES notation for 5-chloro-2,4-difluoro-6-(trifluoromethyl)pyrimidine?
The canonical SMILES for 5-chloro-2,4-difluoro-6-(trifluoromethyl)pyrimidine is Fc1nc(F)c(Cl)c(C(F)(F)F)n1.
What is the InChIKey of 5-chloro-2,4-difluoro-6-(trifluoromethyl)pyrimidine?
The InChIKey is LTRDQYKIIGULAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5ClF5N2/c6-1-2(5(9,10)11)12-4(8)13-3(1)7.
What are the key properties of 5-chloro-2,4-difluoro-6-(trifluoromethyl)pyrimidine?
5-chloro-2,4-difluoro-6-(trifluoromethyl)pyrimidine has a molecular weight of 218.51 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,4-difluoro-6-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 3057449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).