C5Cl2F4N2 — CID 13026342
5-chloro-4-[chloro(difluoro)methyl]-2,6-difluoropyrimidine (PubChem CID 13026342) has the molecular formula C5Cl2F4N2 and a molecular weight of 234.97 g/mol. Its IUPAC name is 5-chloro-4-[chloro(difluoro)methyl]-2,6-difluoropyrimidine.
| Compound Name | 5-chloro-4-[chloro(difluoro)methyl]-2,6-difluoropyrimidine |
|---|---|
| PubChem CID | 13026342 |
| Molecular Formula | C5Cl2F4N2 |
| Molecular Weight | 234.97 g/mol |
| Exact Mass | 233.94 |
| IUPAC Name | 5-chloro-4-[chloro(difluoro)methyl]-2,6-difluoropyrimidine |
| SMILES | Fc1nc(F)c(Cl)c(C(F)(F)Cl)n1 |
| InChI | InChI=1S/C5Cl2F4N2/c6-1-2(5(7,10)11)12-4(9)13-3(1)8 |
| InChIKey | RRDNGRUDPDRKEO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.97 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|