About CID 114986666
CID 114986666 (PubChem CID 114986666) has the molecular formula C4BF4N2-
and a molecular weight of 162.86 g/mol.
Molecular Properties
| Compound Name | CID 114986666 |
| PubChem CID | 114986666 |
| Molecular Formula | C4BF4N2- |
| Molecular Weight | 162.86 g/mol |
| Exact Mass | 163.01 |
| IUPAC Name | — |
| SMILES | F[B-]c1c(F)nc(F)nc1F |
| InChI | InChI=1S/C4BF4N2/c6-2-1(5-9)3(7)11-4(8)10-2/q-1 |
| InChIKey | XOLDMBQELMMKBX-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.86 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 114986666 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 114986666?
The IUPAC name of CID 114986666 (CID 114986666) is not available.
What is the SMILES notation for CID 114986666?
The canonical SMILES for CID 114986666 is F[B-]c1c(F)nc(F)nc1F.
What is the InChIKey of CID 114986666?
The InChIKey is XOLDMBQELMMKBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4BF4N2/c6-2-1(5-9)3(7)11-4(8)10-2/q-1.
What are the key properties of CID 114986666?
CID 114986666 has a molecular weight of 162.86 g/mol, XLogP of 0.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 114986666 is sourced from PubChem (CID 114986666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).