C5F8N4 — CID 12633771
3,5-difluoro-N,N-bis(trifluoromethyl)-1,2,4-triazin-6-amine (PubChem CID 12633771) has the molecular formula C5F8N4 and a molecular weight of 268.07 g/mol. Its IUPAC name is 3,5-difluoro-N,N-bis(trifluoromethyl)-1,2,4-triazin-6-amine.
| Compound Name | 3,5-difluoro-N,N-bis(trifluoromethyl)-1,2,4-triazin-6-amine |
|---|---|
| PubChem CID | 12633771 |
| Molecular Formula | C5F8N4 |
| Molecular Weight | 268.07 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 3,5-difluoro-N,N-bis(trifluoromethyl)-1,2,4-triazin-6-amine |
| SMILES | Fc1nnc(N(C(F)(F)F)C(F)(F)F)c(F)n1 |
| InChI | InChI=1S/C5F8N4/c6-1-2(15-16-3(7)14-1)17(4(8,9)10)5(11,12)13 |
| InChIKey | INQGMQHQRDJKHG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.07 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|