C11F18N2 — CID 12702314
2,4-difluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)pyrimidine (PubChem CID 12702314) has the molecular formula C11F18N2 and a molecular weight of 502.10 g/mol. Its IUPAC name is 2,4-difluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)pyrimidine.
| Compound Name | 2,4-difluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)pyrimidine |
|---|---|
| PubChem CID | 12702314 |
| Molecular Formula | C11F18N2 |
| Molecular Weight | 502.10 g/mol |
| Exact Mass | 501.98 |
| IUPAC Name | 2,4-difluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)pyrimidine |
| SMILES | Fc1nc(F)c(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)c(C(F)(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C11F18N2/c12-3-1(5(14,8(18,19)20)7(16,17)11(27,28)29)2(30-4(13)31-3)6(15,9(21,22)23)10(24,25)26 |
| InChIKey | OJGAQFNJNJNYGX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.10 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|