C17H6F17NO2 — CID 162536667
5,7,8-trifluoro-2,4-bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3,6-dimethoxyquinoline (PubChem CID 162536667) has the molecular formula C17H6F17NO2 and a molecular weight of 579.21 g/mol. Its IUPAC name is 5,7,8-trifluoro-2,4-bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3,6-dimethoxyquinoline.
| Compound Name | 5,7,8-trifluoro-2,4-bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3,6-dimethoxyquinoline |
|---|---|
| PubChem CID | 162536667 |
| Molecular Formula | C17H6F17NO2 |
| Molecular Weight | 579.21 g/mol |
| Exact Mass | 579.01 |
| IUPAC Name | 5,7,8-trifluoro-2,4-bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3,6-dimethoxyquinoline |
| SMILES | COc1c(F)c(F)c2nc(C(F)(C(F)(F)F)C(F)(F)F)c(OC)c(C(F)(C(F)(F)F)C(F)(F)F)c2c1F |
| InChI | InChI=1S/C17H6F17NO2/c1-36-9-4(12(21,14(23,24)25)15(26,27)28)3-5(18)10(37-2)7(20)6(19)8(3)35-11(9)13(22,16(29,30)31)17(32,33)34/h1-2H3 |
| InChIKey | XNPOWFPAMNDNMT-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.21 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|