C7H3F3N2OS — CID 132839309
4,5,7-trifluoro-6-methoxy-2,1,3-benzothiadiazole (PubChem CID 132839309) has the molecular formula C7H3F3N2OS and a molecular weight of 220.17 g/mol. Its IUPAC name is 4,5,7-trifluoro-6-methoxy-2,1,3-benzothiadiazole.
| Compound Name | 4,5,7-trifluoro-6-methoxy-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 132839309 |
| Molecular Formula | C7H3F3N2OS |
| Molecular Weight | 220.17 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | 4,5,7-trifluoro-6-methoxy-2,1,3-benzothiadiazole |
| SMILES | COc1c(F)c(F)c2nsnc2c1F |
| InChI | InChI=1S/C7H3F3N2OS/c1-13-7-3(9)2(8)5-6(4(7)10)12-14-11-5/h1H3 |
| InChIKey | ZDAIBTHRLOUSNZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.17 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|