C10F6N2S — CID 134909937
4,5,6,7,8,9-hexafluorobenzo[g][2,1,3]benzothiadiazole (PubChem CID 134909937) has the molecular formula C10F6N2S and a molecular weight of 294.18 g/mol. Its IUPAC name is 4,5,6,7,8,9-hexafluorobenzo[g][2,1,3]benzothiadiazole.
| Compound Name | 4,5,6,7,8,9-hexafluorobenzo[g][2,1,3]benzothiadiazole |
|---|---|
| PubChem CID | 134909937 |
| Molecular Formula | C10F6N2S |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 4,5,6,7,8,9-hexafluorobenzo[g][2,1,3]benzothiadiazole |
| SMILES | Fc1c(F)c(F)c2c(c1F)c(F)c(F)c1nsnc12 |
| InChI | InChI=1S/C10F6N2S/c11-3-1-2(5(13)7(15)6(3)14)9-10(18-19-17-9)8(16)4(1)12 |
| InChIKey | WLYKYWBWKHXHOX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|