C7H3BrF2N2S — CID 91474988
4-bromo-5,6-difluoro-7-methyl-2,1,3-benzothiadiazole (PubChem CID 91474988) has the molecular formula C7H3BrF2N2S and a molecular weight of 265.08 g/mol. Its IUPAC name is 4-bromo-5,6-difluoro-7-methyl-2,1,3-benzothiadiazole.
| Compound Name | 4-bromo-5,6-difluoro-7-methyl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 91474988 |
| Molecular Formula | C7H3BrF2N2S |
| Molecular Weight | 265.08 g/mol |
| Exact Mass | 263.92 |
| IUPAC Name | 4-bromo-5,6-difluoro-7-methyl-2,1,3-benzothiadiazole |
| SMILES | Cc1c(F)c(F)c(Br)c2nsnc12 |
| InChI | InChI=1S/C7H3BrF2N2S/c1-2-4(9)5(10)3(8)7-6(2)11-13-12-7/h1H3 |
| InChIKey | MTPATHWNDHLBTQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.08 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|