C20H11BrF2N2S — CID 167061698
4-bromo-5,6-difluoro-7-[4-(1-phenylethenyl)phenyl]-2,1,3-benzothiadiazole (PubChem CID 167061698) has the molecular formula C20H11BrF2N2S and a molecular weight of 429.29 g/mol. Its IUPAC name is 4-bromo-5,6-difluoro-7-[4-(1-phenylethenyl)phenyl]-2,1,3-benzothiadiazole.
| Compound Name | 4-bromo-5,6-difluoro-7-[4-(1-phenylethenyl)phenyl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 167061698 |
| Molecular Formula | C20H11BrF2N2S |
| Molecular Weight | 429.29 g/mol |
| Exact Mass | 427.98 |
| IUPAC Name | 4-bromo-5,6-difluoro-7-[4-(1-phenylethenyl)phenyl]-2,1,3-benzothiadiazole |
| SMILES | C=C(c1ccccc1)c1ccc(-c2c(F)c(F)c(Br)c3nsnc23)cc1 |
| InChI | InChI=1S/C20H11BrF2N2S/c1-11(12-5-3-2-4-6-12)13-7-9-14(10-8-13)15-17(22)18(23)16(21)20-19(15)24-26-25-20/h2-10H,1H2 |
| InChIKey | CMRPBXKFHNFYLH-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.29 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|