C58H38N4SSe — CID 153457486
2,8-bis[4-(1,2,2-triphenylethenyl)phenyl]-5-thia-11λ4-selena-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1,3,6,8,10,11-hexaene (PubChem CID 153457486) has the molecular formula C58H38N4SSe and a molecular weight of 902.00 g/mol. Its IUPAC name is 2,8-bis[4-(1,2,2-triphenylethenyl)phenyl]-5-thia-11λ4-selena-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1,3,6,8,10,11-hexaene.
| Compound Name | 2,8-bis[4-(1,2,2-triphenylethenyl)phenyl]-5-thia-11λ4-selena-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1,3,6,8,10,11-hexaene |
|---|---|
| PubChem CID | 153457486 |
| Molecular Formula | C58H38N4SSe |
| Molecular Weight | 902.00 g/mol |
| Exact Mass | 902.20 |
| IUPAC Name | 2,8-bis[4-(1,2,2-triphenylethenyl)phenyl]-5-thia-11λ4-selena-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1,3,6,8,10,11-hexaene |
| SMILES | c1ccc(C(=C(c2ccccc2)c2ccc(-c3c4c(c(-c5ccc(C(=C(c6ccccc6)c6ccccc6)c6ccccc6)cc5)c5nsnc35)N=[Se]=N4)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C58H38N4SSe/c1-7-19-39(20-8-1)49(40-21-9-2-10-22-40)51(43-27-15-5-16-28-43)45-31-35-47(36-32-45)53-55-56(60-63-59-55)54(58-57(53)61-64-62-58)48-37-33-46(34-38-48)52(44-29-17-6-18-30-44)50(41-23-11-3-12-24-41)42-25-13-4-14-26-42/h1-38H |
| InChIKey | SBXWGLLAAOAKLT-UHFFFAOYSA-N |
| XLogP | 15.39 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.00 |
| LogP ≤ 5 | 15.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|