C86H80N2S — CID 142391258
4,7-bis[4-[4-[2,2-bis(4-tert-butylphenyl)-1-phenylethenyl]phenyl]phenyl]-2,1,3-benzothiadiazole (PubChem CID 142391258) has the molecular formula C86H80N2S and a molecular weight of 1173.67 g/mol. Its IUPAC name is 4,7-bis[4-[4-[2,2-bis(4-tert-butylphenyl)-1-phenylethenyl]phenyl]phenyl]-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis[4-[4-[2,2-bis(4-tert-butylphenyl)-1-phenylethenyl]phenyl]phenyl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 142391258 |
| Molecular Formula | C86H80N2S |
| Molecular Weight | 1173.67 g/mol |
| Exact Mass | 1172.60 |
| IUPAC Name | 4,7-bis[4-[4-[2,2-bis(4-tert-butylphenyl)-1-phenylethenyl]phenyl]phenyl]-2,1,3-benzothiadiazole |
| SMILES | CC(C)(C)c1ccc(C(=C(c2ccccc2)c2ccc(-c3ccc(-c4ccc(-c5ccc(-c6ccc(C(=C(c7ccc(C(C)(C)C)cc7)c7ccc(C(C)(C)C)cc7)c7ccccc7)cc6)cc5)c5nsnc45)cc3)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C86H80N2S/c1-83(2,3)71-47-39-67(40-48-71)79(68-41-49-72(50-42-68)84(4,5)6)77(63-19-15-13-16-20-63)65-35-27-59(28-36-65)57-23-31-61(32-24-57)75-55-56-76(82-81(75)87-89-88-82)62-33-25-58(26-34-62)60-29-37-66(38-30-60)78(64-21-17-14-18-22-64)80(69-43-51-73(52-44-69)85(7,8)9)70-45-53-74(54-46-70)86(10,11)12/h13-56H,1-12H3 |
| InChIKey | ZQYCYAGPJPJVQI-UHFFFAOYSA-N |
| XLogP | 23.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1173.67 |
| LogP ≤ 5 | 23.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|