C80H64N4S — CID 155135841
7-[4-[3,6-bis[4-(4-tert-butylphenyl)phenyl]carbazol-9-yl]phenyl]-N,N-bis(4-phenylphenyl)-2,1,3-benzothiadiazol-4-amine (PubChem CID 155135841) has the molecular formula C80H64N4S and a molecular weight of 1113.49 g/mol. Its IUPAC name is 7-[4-[3,6-bis[4-(4-tert-butylphenyl)phenyl]carbazol-9-yl]phenyl]-N,N-bis(4-phenylphenyl)-2,1,3-benzothiadiazol-4-amine.
| Compound Name | 7-[4-[3,6-bis[4-(4-tert-butylphenyl)phenyl]carbazol-9-yl]phenyl]-N,N-bis(4-phenylphenyl)-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 155135841 |
| Molecular Formula | C80H64N4S |
| Molecular Weight | 1113.49 g/mol |
| Exact Mass | 1112.49 |
| IUPAC Name | 7-[4-[3,6-bis[4-(4-tert-butylphenyl)phenyl]carbazol-9-yl]phenyl]-N,N-bis(4-phenylphenyl)-2,1,3-benzothiadiazol-4-amine |
| SMILES | CC(C)(C)c1ccc(-c2ccc(-c3ccc4c(c3)c3cc(-c5ccc(-c6ccc(C(C)(C)C)cc6)cc5)ccc3n4-c3ccc(-c4ccc(N(c5ccc(-c6ccccc6)cc5)c5ccc(-c6ccccc6)cc5)c5nsnc45)cc3)cc2)cc1 |
| InChI | InChI=1S/C80H64N4S/c1-79(2,3)66-37-25-57(26-38-66)55-17-21-61(22-18-55)64-35-48-74-72(51-64)73-52-65(62-23-19-56(20-24-62)58-27-39-67(40-28-58)80(4,5)6)36-49-75(73)84(74)70-45-33-63(34-46-70)71-47-50-76(78-77(71)81-85-82-78)83(68-41-29-59(30-42-68)53-13-9-7-10-14-53)69-43-31-60(32-44-69)54-15-11-8-12-16-54/h7-52H,1-6H3 |
| InChIKey | JGINCSABHMYAGW-UHFFFAOYSA-N |
| XLogP | 22.52 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1113.49 |
| LogP ≤ 5 | 22.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |