C78H54N4SSi — CID 155617414
7-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-N-(4-phenylphenyl)-N-[4-(4-triphenylsilylphenyl)phenyl]-2,1,3-benzothiadiazol-4-amine (PubChem CID 155617414) has the molecular formula C78H54N4SSi and a molecular weight of 1107.47 g/mol. Its IUPAC name is 7-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-N-(4-phenylphenyl)-N-[4-(4-triphenylsilylphenyl)phenyl]-2,1,3-benzothiadiazol-4-amine.
| Compound Name | 7-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-N-(4-phenylphenyl)-N-[4-(4-triphenylsilylphenyl)phenyl]-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 155617414 |
| Molecular Formula | C78H54N4SSi |
| Molecular Weight | 1107.47 g/mol |
| Exact Mass | 1106.38 |
| IUPAC Name | 7-[4-(3,6-diphenylcarbazol-9-yl)phenyl]-N-(4-phenylphenyl)-N-[4-(4-triphenylsilylphenyl)phenyl]-2,1,3-benzothiadiazol-4-amine |
| SMILES | c1ccc(-c2ccc(N(c3ccc(-c4ccc([Si](c5ccccc5)(c5ccccc5)c5ccccc5)cc4)cc3)c3ccc(-c4ccc(-n5c6ccc(-c7ccccc7)cc6c6cc(-c7ccccc7)ccc65)cc4)c4nsnc34)cc2)cc1 |
| InChI | InChI=1S/C78H54N4SSi/c1-7-19-55(20-8-1)58-31-41-64(42-32-58)81(65-43-33-59(34-44-65)60-37-47-70(48-38-60)84(67-25-13-4-14-26-67,68-27-15-5-16-28-68)69-29-17-6-18-30-69)76-52-49-71(77-78(76)80-83-79-77)61-35-45-66(46-36-61)82-74-50-39-62(56-21-9-2-10-22-56)53-72(74)73-54-63(40-51-75(73)82)57-23-11-3-12-24-57/h1-54H |
| InChIKey | ZVNRWFQCGZTFEI-UHFFFAOYSA-N |
| XLogP | 17.97 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1107.47 |
| LogP ≤ 5 | 17.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|