C18H8Br2F2N2S — CID 132509972
4,7-bis(4-bromophenyl)-5,6-difluoro-2,1,3-benzothiadiazole (PubChem CID 132509972) has the molecular formula C18H8Br2F2N2S and a molecular weight of 482.15 g/mol. Its IUPAC name is 4,7-bis(4-bromophenyl)-5,6-difluoro-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis(4-bromophenyl)-5,6-difluoro-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 132509972 |
| Molecular Formula | C18H8Br2F2N2S |
| Molecular Weight | 482.15 g/mol |
| Exact Mass | 479.87 |
| IUPAC Name | 4,7-bis(4-bromophenyl)-5,6-difluoro-2,1,3-benzothiadiazole |
| SMILES | Fc1c(F)c(-c2ccc(Br)cc2)c2nsnc2c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H8Br2F2N2S/c19-11-5-1-9(2-6-11)13-15(21)16(22)14(18-17(13)23-25-24-18)10-3-7-12(20)8-4-10/h1-8H |
| InChIKey | HYCLHUVHLHINQR-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.15 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |