C12H6Br2N4S — CID 139048756
3,4-bis(6-bromo-3-pyridinyl)-1,2,5-thiadiazole (PubChem CID 139048756) has the molecular formula C12H6Br2N4S and a molecular weight of 398.08 g/mol. Its IUPAC name is 3,4-bis(6-bromo-3-pyridinyl)-1,2,5-thiadiazole.
| Compound Name | 3,4-bis(6-bromo-3-pyridinyl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 139048756 |
| Molecular Formula | C12H6Br2N4S |
| Molecular Weight | 398.08 g/mol |
| Exact Mass | 395.87 |
| IUPAC Name | 3,4-bis(6-bromo-3-pyridinyl)-1,2,5-thiadiazole |
| SMILES | Brc1ccc(-c2nsnc2-c2ccc(Br)nc2)cn1 |
| InChI | InChI=1S/C12H6Br2N4S/c13-9-3-1-7(5-15-9)11-12(18-19-17-11)8-2-4-10(14)16-6-8/h1-6H |
| InChIKey | FZLMFEFOKKMTGJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.08 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|