C10H14BrNO2 — CID 165356587
3-(6-bromo-3-pyridinyl)pentane-1,5-diol (PubChem CID 165356587) has the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. Its IUPAC name is 3-(6-bromo-3-pyridinyl)pentane-1,5-diol.
| Compound Name | 3-(6-bromo-3-pyridinyl)pentane-1,5-diol |
|---|---|
| PubChem CID | 165356587 |
| Molecular Formula | C10H14BrNO2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 3-(6-bromo-3-pyridinyl)pentane-1,5-diol |
| SMILES | OCCC(CCO)c1ccc(Br)nc1 |
| InChI | InChI=1S/C10H14BrNO2/c11-10-2-1-9(7-12-10)8(3-5-13)4-6-14/h1-2,7-8,13-14H,3-6H2 |
| InChIKey | OZKIIAQOZBVQRH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|