C8H6Br2N2OS — CID 90084924
4,7-dibromo-5-methoxy-6-methyl-2,1,3-benzothiadiazole (PubChem CID 90084924) has the molecular formula C8H6Br2N2OS and a molecular weight of 338.02 g/mol. Its IUPAC name is 4,7-dibromo-5-methoxy-6-methyl-2,1,3-benzothiadiazole.
| Compound Name | 4,7-dibromo-5-methoxy-6-methyl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 90084924 |
| Molecular Formula | C8H6Br2N2OS |
| Molecular Weight | 338.02 g/mol |
| Exact Mass | 335.86 |
| IUPAC Name | 4,7-dibromo-5-methoxy-6-methyl-2,1,3-benzothiadiazole |
| SMILES | COc1c(C)c(Br)c2nsnc2c1Br |
| InChI | InChI=1S/C8H6Br2N2OS/c1-3-4(9)6-7(12-14-11-6)5(10)8(3)13-2/h1-2H3 |
| InChIKey | DDKLGSAXVPTMAI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.02 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |