C11H13BrO4 — CID 11403516
2-bromo-3,5,6-trimethoxy-4-methylbenzaldehyde (PubChem CID 11403516) has the molecular formula C11H13BrO4 and a molecular weight of 289.12 g/mol. Its IUPAC name is 2-bromo-3,5,6-trimethoxy-4-methylbenzaldehyde.
| Compound Name | 2-bromo-3,5,6-trimethoxy-4-methylbenzaldehyde |
|---|---|
| PubChem CID | 11403516 |
| Molecular Formula | C11H13BrO4 |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 2-bromo-3,5,6-trimethoxy-4-methylbenzaldehyde |
| SMILES | COc1c(C)c(OC)c(OC)c(C=O)c1Br |
| InChI | InChI=1S/C11H13BrO4/c1-6-9(14-2)8(12)7(5-13)11(16-4)10(6)15-3/h5H,1-4H3 |
| InChIKey | VAROOAKQUJJIGP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|