C11H13BrO3 — CID 11097704
2-bromo-3,6-dimethoxy-4,5-dimethylbenzaldehyde (PubChem CID 11097704) has the molecular formula C11H13BrO3 and a molecular weight of 273.13 g/mol. Its IUPAC name is 2-bromo-3,6-dimethoxy-4,5-dimethylbenzaldehyde.
| Compound Name | 2-bromo-3,6-dimethoxy-4,5-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 11097704 |
| Molecular Formula | C11H13BrO3 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 2-bromo-3,6-dimethoxy-4,5-dimethylbenzaldehyde |
| SMILES | COc1c(C)c(C)c(OC)c(C=O)c1Br |
| InChI | InChI=1S/C11H13BrO3/c1-6-7(2)11(15-4)9(12)8(5-13)10(6)14-3/h5H,1-4H3 |
| InChIKey | HAVSEOPGAUZMLX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|