C10H8Br2O2 — CID 10969238
4,6-dibromo-2,5-dimethylbenzene-1,3-dicarbaldehyde (PubChem CID 10969238) has the molecular formula C10H8Br2O2 and a molecular weight of 319.98 g/mol. Its IUPAC name is 4,6-dibromo-2,5-dimethylbenzene-1,3-dicarbaldehyde.
| Compound Name | 4,6-dibromo-2,5-dimethylbenzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 10969238 |
| Molecular Formula | C10H8Br2O2 |
| Molecular Weight | 319.98 g/mol |
| Exact Mass | 317.89 |
| IUPAC Name | 4,6-dibromo-2,5-dimethylbenzene-1,3-dicarbaldehyde |
| SMILES | Cc1c(Br)c(C=O)c(C)c(C=O)c1Br |
| InChI | InChI=1S/C10H8Br2O2/c1-5-7(3-13)9(11)6(2)10(12)8(5)4-14/h3-4H,1-2H3 |
| InChIKey | NEUGHKBZWCHUNZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.98 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|